C11H13Cl — CID 139664052
2-(3-chloroprop-2-enyl)-1,3-dimethylbenzene (PubChem CID 139664052) has the molecular formula C11H13Cl and a molecular weight of 180.68 g/mol. Its IUPAC name is 2-(3-chloroprop-2-enyl)-1,3-dimethylbenzene.
| Compound Name | 2-(3-chloroprop-2-enyl)-1,3-dimethylbenzene |
|---|---|
| PubChem CID | 139664052 |
| Molecular Formula | C11H13Cl |
| Molecular Weight | 180.68 g/mol |
| Exact Mass | 180.07 |
| IUPAC Name | 2-(3-chloroprop-2-enyl)-1,3-dimethylbenzene |
| SMILES | Cc1cccc(C)c1CC=CCl |
| InChI | InChI=1S/C11H13Cl/c1-9-5-3-6-10(2)11(9)7-4-8-12/h3-6,8H,7H2,1-2H3 |
| InChIKey | HOITYQGFFVVALC-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.68 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |