C20H23NO2S — CID 139664466
[(6R,8R,9S,10R,13S,14S)-10,13-dimethyl-3,17-dioxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-6-yl] thiocyanate (PubChem CID 139664466) has the molecular formula C20H23NO2S and a molecular weight of 341.48 g/mol. Its IUPAC name is [(6R,8R,9S,10R,13S,14S)-10,13-dimethyl-3,17-dioxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-6-yl] thiocyanate.
| Compound Name | [(6R,8R,9S,10R,13S,14S)-10,13-dimethyl-3,17-dioxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-6-yl] thiocyanate |
|---|---|
| PubChem CID | 139664466 |
| Molecular Formula | C20H23NO2S |
| Molecular Weight | 341.48 g/mol |
| Exact Mass | 341.14 |
| IUPAC Name | [(6R,8R,9S,10R,13S,14S)-10,13-dimethyl-3,17-dioxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-6-yl] thiocyanate |
| SMILES | C[C@]12C=CC(=O)C=C1[C@H](SC#N)C[C@@H]1[C@@H]2CC[C@]2(C)C(=O)CC[C@@H]12 |
| InChI | InChI=1S/C20H23NO2S/c1-19-7-5-12(22)9-16(19)17(24-11-21)10-13-14-3-4-18(23)20(14,2)8-6-15(13)19/h5,7,9,13-15,17H,3-4,6,8,10H2,1-2H3/t13-,14-,15-,17+,19+,20-/m0/s1 |
| InChIKey | KBCRHFSGBXRXSI-XOJMLDNQSA-N |
| XLogP | 4.06 |
| TPSA | 57.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.48 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|