C7H7N3O3 — CID 139664502
1,3-bis(ethenyl)-1,3,5-triazinane-2,4,6-trione (PubChem CID 139664502) has the molecular formula C7H7N3O3 and a molecular weight of 181.15 g/mol. Its IUPAC name is 1,3-bis(ethenyl)-1,3,5-triazinane-2,4,6-trione.
| Compound Name | 1,3-bis(ethenyl)-1,3,5-triazinane-2,4,6-trione |
|---|---|
| PubChem CID | 139664502 |
| Molecular Formula | C7H7N3O3 |
| Molecular Weight | 181.15 g/mol |
| Exact Mass | 181.05 |
| IUPAC Name | 1,3-bis(ethenyl)-1,3,5-triazinane-2,4,6-trione |
| SMILES | C=Cn1c(=O)[nH]c(=O)n(C=C)c1=O |
| InChI | InChI=1S/C7H7N3O3/c1-3-9-5(11)8-6(12)10(4-2)7(9)13/h3-4H,1-2H2,(H,8,11,12) |
| InChIKey | KJKKZOHPDFPNCD-UHFFFAOYSA-N |
| XLogP | -1.10 |
| TPSA | 76.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.15 |
| LogP ≤ 5 | -1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |