About 2-(1,3-dioxan-2-yl)ethyl-hydroxy-triphenyl-λ5-phosphane
2-(1,3-dioxan-2-yl)ethyl-hydroxy-triphenyl-λ5-phosphane (PubChem CID 139665210) has the molecular formula C24H27O3P
and a molecular weight of 394.45 g/mol. Its IUPAC name is 2-(1,3-dioxan-2-yl)ethyl-hydroxy-triphenyl-λ5-phosphane.
Molecular Properties
| Compound Name | 2-(1,3-dioxan-2-yl)ethyl-hydroxy-triphenyl-λ5-phosphane |
| PubChem CID | 139665210 |
| Molecular Formula | C24H27O3P |
| Molecular Weight | 394.45 g/mol |
| Exact Mass | 394.17 |
| IUPAC Name | 2-(1,3-dioxan-2-yl)ethyl-hydroxy-triphenyl-λ5-phosphane |
| SMILES | OP(CCC1OCCCO1)(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C24H27O3P/c25-28(21-11-4-1-5-12-21,22-13-6-2-7-14-22,23-15-8-3-9-16-23)20-17-24-26-18-10-19-27-24/h1-9,11-16,24-25H,10,17-20H2 |
| InChIKey | PSYLDUPXCDDSOK-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 394.45 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 2-(1,3-dioxan-2-yl)ethyl-hydroxy-triphenyl-λ5-phosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1,3-dioxan-2-yl)ethyl-hydroxy-triphenyl-λ5-phosphane?
The IUPAC name of 2-(1,3-dioxan-2-yl)ethyl-hydroxy-triphenyl-λ5-phosphane (CID 139665210) is 2-(1,3-dioxan-2-yl)ethyl-hydroxy-triphenyl-λ5-phosphane.
What is the SMILES notation for 2-(1,3-dioxan-2-yl)ethyl-hydroxy-triphenyl-λ5-phosphane?
The canonical SMILES for 2-(1,3-dioxan-2-yl)ethyl-hydroxy-triphenyl-λ5-phosphane is OP(CCC1OCCCO1)(c1ccccc1)(c1ccccc1)c1ccccc1.
What is the InChIKey of 2-(1,3-dioxan-2-yl)ethyl-hydroxy-triphenyl-λ5-phosphane?
The InChIKey is PSYLDUPXCDDSOK-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H27O3P/c25-28(21-11-4-1-5-12-21,22-13-6-2-7-14-22,23-15-8-3-9-16-23)20-17-24-26-18-10-19-27-24/h1-9,11-16,24-25H,10,17-20H2.
What are the key properties of 2-(1,3-dioxan-2-yl)ethyl-hydroxy-triphenyl-λ5-phosphane?
2-(1,3-dioxan-2-yl)ethyl-hydroxy-triphenyl-λ5-phosphane has a molecular weight of 394.45 g/mol, XLogP of 3.58, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,3-dioxan-2-yl)ethyl-hydroxy-triphenyl-λ5-phosphane is sourced from PubChem (CID 139665210), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).