About 9-(4-bromophenyl)sulfanylnona-6,8-diyn-1-ol
9-(4-bromophenyl)sulfanylnona-6,8-diyn-1-ol (PubChem CID 139665440) has the molecular formula C15H15BrOS
and a molecular weight of 323.25 g/mol. Its IUPAC name is 9-(4-bromophenyl)sulfanylnona-6,8-diyn-1-ol.
Molecular Properties
| Compound Name | 9-(4-bromophenyl)sulfanylnona-6,8-diyn-1-ol |
| PubChem CID | 139665440 |
| Molecular Formula | C15H15BrOS |
| Molecular Weight | 323.25 g/mol |
| Exact Mass | 322.00 |
| IUPAC Name | 9-(4-bromophenyl)sulfanylnona-6,8-diyn-1-ol |
| SMILES | OCCCCCC#CC#CSc1ccc(Br)cc1 |
| InChI | InChI=1S/C15H15BrOS/c16-14-8-10-15(11-9-14)18-13-7-5-3-1-2-4-6-12-17/h8-11,17H,1-2,4,6,12H2 |
| InChIKey | BWVLLHBYUAZRNP-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 323.25 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 9-(4-bromophenyl)sulfanylnona-6,8-diyn-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-(4-bromophenyl)sulfanylnona-6,8-diyn-1-ol?
The IUPAC name of 9-(4-bromophenyl)sulfanylnona-6,8-diyn-1-ol (CID 139665440) is 9-(4-bromophenyl)sulfanylnona-6,8-diyn-1-ol.
What is the SMILES notation for 9-(4-bromophenyl)sulfanylnona-6,8-diyn-1-ol?
The canonical SMILES for 9-(4-bromophenyl)sulfanylnona-6,8-diyn-1-ol is OCCCCCC#CC#CSc1ccc(Br)cc1.
What is the InChIKey of 9-(4-bromophenyl)sulfanylnona-6,8-diyn-1-ol?
The InChIKey is BWVLLHBYUAZRNP-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H15BrOS/c16-14-8-10-15(11-9-14)18-13-7-5-3-1-2-4-6-12-17/h8-11,17H,1-2,4,6,12H2.
What are the key properties of 9-(4-bromophenyl)sulfanylnona-6,8-diyn-1-ol?
9-(4-bromophenyl)sulfanylnona-6,8-diyn-1-ol has a molecular weight of 323.25 g/mol, XLogP of 4.06, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 9-(4-bromophenyl)sulfanylnona-6,8-diyn-1-ol is sourced from PubChem (CID 139665440), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).