C31H16F12N4O2 — CID 139665622
[4-[2-[2-[2-[4-(cyanoamino)-2-(trifluoromethyl)phenoxy]phenyl]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenoxy]-3-(trifluoromethyl)phenyl]cyanamide (PubChem CID 139665622) has the molecular formula C31H16F12N4O2 and a molecular weight of 704.47 g/mol. Its IUPAC name is [4-[2-[2-[2-[4-(cyanoamino)-2-(trifluoromethyl)phenoxy]phenyl]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenoxy]-3-(trifluoromethyl)phenyl]cyanamide.
| Compound Name | [4-[2-[2-[2-[4-(cyanoamino)-2-(trifluoromethyl)phenoxy]phenyl]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenoxy]-3-(trifluoromethyl)phenyl]cyanamide |
|---|---|
| PubChem CID | 139665622 |
| Molecular Formula | C31H16F12N4O2 |
| Molecular Weight | 704.47 g/mol |
| Exact Mass | 704.11 |
| IUPAC Name | [4-[2-[2-[2-[4-(cyanoamino)-2-(trifluoromethyl)phenoxy]phenyl]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenoxy]-3-(trifluoromethyl)phenyl]cyanamide |
| SMILES | N#CNc1ccc(Oc2ccccc2C(c2ccccc2Oc2ccc(NC#N)cc2C(F)(F)F)(C(F)(F)F)C(F)(F)F)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C31H16F12N4O2/c32-28(33,34)21-13-17(46-15-44)9-11-25(21)48-23-7-3-1-5-19(23)27(30(38,39)40,31(41,42)43)20-6-2-4-8-24(20)49-26-12-10-18(47-16-45)14-22(26)29(35,36)37/h1-14,46-47H |
| InChIKey | FVRFPKULOQCIKQ-UHFFFAOYSA-N |
| XLogP | 10.51 |
| TPSA | 90.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 704.47 |
| LogP ≤ 5 | 10.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|