C21H23NO6 — CID 139665936
[2,6-diacetyl-3-(2-aminoethoxy)phenyl] 2-phenylmethoxyacetate (PubChem CID 139665936) has the molecular formula C21H23NO6 and a molecular weight of 385.42 g/mol. Its IUPAC name is [2,6-diacetyl-3-(2-aminoethoxy)phenyl] 2-phenylmethoxyacetate.
| Compound Name | [2,6-diacetyl-3-(2-aminoethoxy)phenyl] 2-phenylmethoxyacetate |
|---|---|
| PubChem CID | 139665936 |
| Molecular Formula | C21H23NO6 |
| Molecular Weight | 385.42 g/mol |
| Exact Mass | 385.15 |
| IUPAC Name | [2,6-diacetyl-3-(2-aminoethoxy)phenyl] 2-phenylmethoxyacetate |
| SMILES | CC(=O)c1ccc(OCCN)c(C(C)=O)c1OC(=O)COCc1ccccc1 |
| InChI | InChI=1S/C21H23NO6/c1-14(23)17-8-9-18(27-11-10-22)20(15(2)24)21(17)28-19(25)13-26-12-16-6-4-3-5-7-16/h3-9H,10-13,22H2,1-2H3 |
| InChIKey | QRNIUGXDLLSZMX-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 104.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.42 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|