C29H51N3O3 — CID 139666026
1-N,3-N,5-N-tris(2-methylcyclohexyl)pentane-1,3,5-tricarboxamide (PubChem CID 139666026) has the molecular formula C29H51N3O3 and a molecular weight of 489.75 g/mol. Its IUPAC name is 1-N,3-N,5-N-tris(2-methylcyclohexyl)pentane-1,3,5-tricarboxamide.
| Compound Name | 1-N,3-N,5-N-tris(2-methylcyclohexyl)pentane-1,3,5-tricarboxamide |
|---|---|
| PubChem CID | 139666026 |
| Molecular Formula | C29H51N3O3 |
| Molecular Weight | 489.75 g/mol |
| Exact Mass | 489.39 |
| IUPAC Name | 1-N,3-N,5-N-tris(2-methylcyclohexyl)pentane-1,3,5-tricarboxamide |
| SMILES | CC1CCCCC1NC(=O)CCC(CCC(=O)NC1CCCCC1C)C(=O)NC1CCCCC1C |
| InChI | InChI=1S/C29H51N3O3/c1-20-10-4-7-13-24(20)30-27(33)18-16-23(29(35)32-26-15-9-6-12-22(26)3)17-19-28(34)31-25-14-8-5-11-21(25)2/h20-26H,4-19H2,1-3H3,(H,30,33)(H,31,34)(H,32,35) |
| InChIKey | BBFGJLOVMWXKKI-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.75 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |