About 8-[2-(2,6-dichlorophenyl)ethenyl]-2-methylimidazo[1,2-a]pyridine;hydrochloride
8-[2-(2,6-dichlorophenyl)ethenyl]-2-methylimidazo[1,2-a]pyridine;hydrochloride (PubChem CID 139666536) has the molecular formula C16H13Cl3N2
and a molecular weight of 339.65 g/mol. Its IUPAC name is 8-[2-(2,6-dichlorophenyl)ethenyl]-2-methylimidazo[1,2-a]pyridine;hydrochloride.
Molecular Properties
| Compound Name | 8-[2-(2,6-dichlorophenyl)ethenyl]-2-methylimidazo[1,2-a]pyridine;hydrochloride |
| PubChem CID | 139666536 |
| Molecular Formula | C16H13Cl3N2 |
| Molecular Weight | 339.65 g/mol |
| Exact Mass | 338.01 |
| IUPAC Name | 8-[2-(2,6-dichlorophenyl)ethenyl]-2-methylimidazo[1,2-a]pyridine;hydrochloride |
| SMILES | Cc1cn2cccc(C=Cc3c(Cl)cccc3Cl)c2n1.Cl |
| InChI | InChI=1S/C16H12Cl2N2.ClH/c1-11-10-20-9-3-4-12(16(20)19-11)7-8-13-14(17)5-2-6-15(13)18;/h2-10H,1H3;1H |
| InChIKey | IHBQXDQEUUSNCJ-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 17.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 339.65 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 8-[2-(2,6-dichlorophenyl)ethenyl]-2-methylimidazo[1,2-a]pyridine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-[2-(2,6-dichlorophenyl)ethenyl]-2-methylimidazo[1,2-a]pyridine;hydrochloride?
The IUPAC name of 8-[2-(2,6-dichlorophenyl)ethenyl]-2-methylimidazo[1,2-a]pyridine;hydrochloride (CID 139666536) is 8-[2-(2,6-dichlorophenyl)ethenyl]-2-methylimidazo[1,2-a]pyridine;hydrochloride.
What is the SMILES notation for 8-[2-(2,6-dichlorophenyl)ethenyl]-2-methylimidazo[1,2-a]pyridine;hydrochloride?
The canonical SMILES for 8-[2-(2,6-dichlorophenyl)ethenyl]-2-methylimidazo[1,2-a]pyridine;hydrochloride is Cc1cn2cccc(C=Cc3c(Cl)cccc3Cl)c2n1.Cl.
What is the InChIKey of 8-[2-(2,6-dichlorophenyl)ethenyl]-2-methylimidazo[1,2-a]pyridine;hydrochloride?
The InChIKey is IHBQXDQEUUSNCJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H12Cl2N2.ClH/c1-11-10-20-9-3-4-12(16(20)19-11)7-8-13-14(17)5-2-6-15(13)18;/h2-10H,1H3;1H.
What are the key properties of 8-[2-(2,6-dichlorophenyl)ethenyl]-2-methylimidazo[1,2-a]pyridine;hydrochloride?
8-[2-(2,6-dichlorophenyl)ethenyl]-2-methylimidazo[1,2-a]pyridine;hydrochloride has a molecular weight of 339.65 g/mol, XLogP of 5.54, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 8-[2-(2,6-dichlorophenyl)ethenyl]-2-methylimidazo[1,2-a]pyridine;hydrochloride is sourced from PubChem (CID 139666536), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).