C19H26F3NO9 — CID 139666561
[(2R,3R,4R,5R,6R)-3,4-diacetyl-3,4-dihydroxy-6-pent-4-enoxy-5-[(2,2,2-trifluoroacetyl)amino]oxan-2-yl]methyl acetate (PubChem CID 139666561) has the molecular formula C19H26F3NO9 and a molecular weight of 469.41 g/mol. Its IUPAC name is [(2R,3R,4R,5R,6R)-3,4-diacetyl-3,4-dihydroxy-6-pent-4-enoxy-5-[(2,2,2-trifluoroacetyl)amino]oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4R,5R,6R)-3,4-diacetyl-3,4-dihydroxy-6-pent-4-enoxy-5-[(2,2,2-trifluoroacetyl)amino]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 139666561 |
| Molecular Formula | C19H26F3NO9 |
| Molecular Weight | 469.41 g/mol |
| Exact Mass | 469.16 |
| IUPAC Name | [(2R,3R,4R,5R,6R)-3,4-diacetyl-3,4-dihydroxy-6-pent-4-enoxy-5-[(2,2,2-trifluoroacetyl)amino]oxan-2-yl]methyl acetate |
| SMILES | C=CCCCO[C@@H]1O[C@H](COC(C)=O)[C@](O)(C(C)=O)[C@@](O)(C(C)=O)[C@H]1NC(=O)C(F)(F)F |
| InChI | InChI=1S/C19H26F3NO9/c1-5-6-7-8-30-15-14(23-16(27)19(20,21)22)18(29,11(3)25)17(28,10(2)24)13(32-15)9-31-12(4)26/h5,13-15,28-29H,1,6-9H2,2-4H3,(H,23,27)/t13-,14+,15-,17-,18-/m1/s1 |
| InChIKey | RUOGHOYKJCREHG-JAPOXJDPSA-N |
| XLogP | -0.06 |
| TPSA | 148.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.41 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|