C17H33NO — CID 139667999
1-(5,5-dimethylhex-1-enyl)-2,2,6,6-tetramethylpiperidin-4-ol (PubChem CID 139667999) has the molecular formula C17H33NO and a molecular weight of 267.46 g/mol. Its IUPAC name is 1-(5,5-dimethylhex-1-enyl)-2,2,6,6-tetramethylpiperidin-4-ol.
| Compound Name | 1-(5,5-dimethylhex-1-enyl)-2,2,6,6-tetramethylpiperidin-4-ol |
|---|---|
| PubChem CID | 139667999 |
| Molecular Formula | C17H33NO |
| Molecular Weight | 267.46 g/mol |
| Exact Mass | 267.26 |
| IUPAC Name | 1-(5,5-dimethylhex-1-enyl)-2,2,6,6-tetramethylpiperidin-4-ol |
| SMILES | CC(C)(C)CCC=CN1C(C)(C)CC(O)CC1(C)C |
| InChI | InChI=1S/C17H33NO/c1-15(2,3)10-8-9-11-18-16(4,5)12-14(19)13-17(18,6)7/h9,11,14,19H,8,10,12-13H2,1-7H3 |
| InChIKey | NXNMMDNPRUUTTN-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.46 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |