C43H40N2O2 — CID 139669163
4-[4-[9-[4-(4-aminophenoxy)-2,3,5-trimethylphenyl]fluoren-9-yl]-2,3,6-trimethylphenoxy]aniline (PubChem CID 139669163) has the molecular formula C43H40N2O2 and a molecular weight of 616.81 g/mol. Its IUPAC name is 4-[4-[9-[4-(4-aminophenoxy)-2,3,5-trimethylphenyl]fluoren-9-yl]-2,3,6-trimethylphenoxy]aniline.
| Compound Name | 4-[4-[9-[4-(4-aminophenoxy)-2,3,5-trimethylphenyl]fluoren-9-yl]-2,3,6-trimethylphenoxy]aniline |
|---|---|
| PubChem CID | 139669163 |
| Molecular Formula | C43H40N2O2 |
| Molecular Weight | 616.81 g/mol |
| Exact Mass | 616.31 |
| IUPAC Name | 4-[4-[9-[4-(4-aminophenoxy)-2,3,5-trimethylphenyl]fluoren-9-yl]-2,3,6-trimethylphenoxy]aniline |
| SMILES | Cc1cc(C2(c3cc(C)c(Oc4ccc(N)cc4)c(C)c3C)c3ccccc3-c3ccccc32)c(C)c(C)c1Oc1ccc(N)cc1 |
| InChI | InChI=1S/C43H40N2O2/c1-25-23-39(27(3)29(5)41(25)46-33-19-15-31(44)16-20-33)43(37-13-9-7-11-35(37)36-12-8-10-14-38(36)43)40-24-26(2)42(30(6)28(40)4)47-34-21-17-32(45)18-22-34/h7-24H,44-45H2,1-6H3 |
| InChIKey | SLNLTAZOYOXKNQ-UHFFFAOYSA-N |
| XLogP | 10.65 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.81 |
| LogP ≤ 5 | 10.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|