C43H72O5 — CID 139669773
(2-hydroxy-3-icosa-8,11,14-trienoyloxypropyl) icosa-8,11,14-trienoate (PubChem CID 139669773) has the molecular formula C43H72O5 and a molecular weight of 669.04 g/mol. Its IUPAC name is (2-hydroxy-3-icosa-8,11,14-trienoyloxypropyl) icosa-8,11,14-trienoate.
| Compound Name | (2-hydroxy-3-icosa-8,11,14-trienoyloxypropyl) icosa-8,11,14-trienoate |
|---|---|
| PubChem CID | 139669773 |
| Molecular Formula | C43H72O5 |
| Molecular Weight | 669.04 g/mol |
| Exact Mass | 668.54 |
| IUPAC Name | (2-hydroxy-3-icosa-8,11,14-trienoyloxypropyl) icosa-8,11,14-trienoate |
| SMILES | CCCCCC=CCC=CCC=CCCCCCCC(=O)OCC(O)COC(=O)CCCCCCC=CCC=CCC=CCCCCC |
| InChI | InChI=1S/C43H72O5/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-35-37-42(45)47-39-41(44)40-48-43(46)38-36-34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-4-2/h11-14,17-20,23-26,41,44H,3-10,15-16,21-22,27-40H2,1-2H3 |
| InChIKey | YTOCFNTUAXVUGF-UHFFFAOYSA-N |
| XLogP | 12.17 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 34 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 669.04 |
| LogP ≤ 5 | 12.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|