About 6-ethoxy-1-(4-methoxyphenyl)-2,2,4-trimethylquinoline
6-ethoxy-1-(4-methoxyphenyl)-2,2,4-trimethylquinoline (PubChem CID 139670132) has the molecular formula C21H25NO2
and a molecular weight of 323.44 g/mol. Its IUPAC name is 6-ethoxy-1-(4-methoxyphenyl)-2,2,4-trimethylquinoline.
Molecular Properties
| Compound Name | 6-ethoxy-1-(4-methoxyphenyl)-2,2,4-trimethylquinoline |
| PubChem CID | 139670132 |
| Molecular Formula | C21H25NO2 |
| Molecular Weight | 323.44 g/mol |
| Exact Mass | 323.19 |
| IUPAC Name | 6-ethoxy-1-(4-methoxyphenyl)-2,2,4-trimethylquinoline |
| SMILES | CCOc1ccc2c(c1)C(C)=CC(C)(C)N2c1ccc(OC)cc1 |
| InChI | InChI=1S/C21H25NO2/c1-6-24-18-11-12-20-19(13-18)15(2)14-21(3,4)22(20)16-7-9-17(23-5)10-8-16/h7-14H,6H2,1-5H3 |
| InChIKey | UHAZRZKOLWQNAT-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 323.44 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-ethoxy-1-(4-methoxyphenyl)-2,2,4-trimethylquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-ethoxy-1-(4-methoxyphenyl)-2,2,4-trimethylquinoline?
The IUPAC name of 6-ethoxy-1-(4-methoxyphenyl)-2,2,4-trimethylquinoline (CID 139670132) is 6-ethoxy-1-(4-methoxyphenyl)-2,2,4-trimethylquinoline.
What is the SMILES notation for 6-ethoxy-1-(4-methoxyphenyl)-2,2,4-trimethylquinoline?
The canonical SMILES for 6-ethoxy-1-(4-methoxyphenyl)-2,2,4-trimethylquinoline is CCOc1ccc2c(c1)C(C)=CC(C)(C)N2c1ccc(OC)cc1.
What is the InChIKey of 6-ethoxy-1-(4-methoxyphenyl)-2,2,4-trimethylquinoline?
The InChIKey is UHAZRZKOLWQNAT-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H25NO2/c1-6-24-18-11-12-20-19(13-18)15(2)14-21(3,4)22(20)16-7-9-17(23-5)10-8-16/h7-14H,6H2,1-5H3.
What are the key properties of 6-ethoxy-1-(4-methoxyphenyl)-2,2,4-trimethylquinoline?
6-ethoxy-1-(4-methoxyphenyl)-2,2,4-trimethylquinoline has a molecular weight of 323.44 g/mol, XLogP of 5.43, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-ethoxy-1-(4-methoxyphenyl)-2,2,4-trimethylquinoline is sourced from PubChem (CID 139670132), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).