C55H44F6N2O6 — CID 139670221
N-[4-[4-[1,1,1,3,3,3-hexafluoro-2-[4-[4-(4-methoxy-N-(4-methoxyphenyl)anilino)phenoxy]phenyl]propan-2-yl]phenoxy]phenyl]-4-methoxy-N-(4-methoxyphenyl)aniline (PubChem CID 139670221) has the molecular formula C55H44F6N2O6 and a molecular weight of 942.95 g/mol. Its IUPAC name is N-[4-[4-[1,1,1,3,3,3-hexafluoro-2-[4-[4-(4-methoxy-N-(4-methoxyphenyl)anilino)phenoxy]phenyl]propan-2-yl]phenoxy]phenyl]-4-methoxy-N-(4-methoxyphenyl)aniline.
| Compound Name | N-[4-[4-[1,1,1,3,3,3-hexafluoro-2-[4-[4-(4-methoxy-N-(4-methoxyphenyl)anilino)phenoxy]phenyl]propan-2-yl]phenoxy]phenyl]-4-methoxy-N-(4-methoxyphenyl)aniline |
|---|---|
| PubChem CID | 139670221 |
| Molecular Formula | C55H44F6N2O6 |
| Molecular Weight | 942.95 g/mol |
| Exact Mass | 942.31 |
| IUPAC Name | N-[4-[4-[1,1,1,3,3,3-hexafluoro-2-[4-[4-(4-methoxy-N-(4-methoxyphenyl)anilino)phenoxy]phenyl]propan-2-yl]phenoxy]phenyl]-4-methoxy-N-(4-methoxyphenyl)aniline |
| SMILES | COc1ccc(N(c2ccc(OC)cc2)c2ccc(Oc3ccc(C(c4ccc(Oc5ccc(N(c6ccc(OC)cc6)c6ccc(OC)cc6)cc5)cc4)(C(F)(F)F)C(F)(F)F)cc3)cc2)cc1 |
| InChI | InChI=1S/C55H44F6N2O6/c1-64-45-25-9-39(10-26-45)62(40-11-27-46(65-2)28-12-40)43-17-33-51(34-18-43)68-49-21-5-37(6-22-49)53(54(56,57)58,55(59,60)61)38-7-23-50(24-8-38)69-52-35-19-44(20-36-52)63(41-13-29-47(66-3)30-14-41)42-15-31-48(67-4)32-16-42/h5-36H,1-4H3 |
| InChIKey | XLWQUMJWSNITFZ-UHFFFAOYSA-N |
| XLogP | 15.66 |
| TPSA | 61.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 69 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 942.95 |
| LogP ≤ 5 | 15.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |