C8H10O3 — CID 139670653
3,4a,5,6-tetrahydro-2H-1,4-benzodioxin-7-one (PubChem CID 139670653) has the molecular formula C8H10O3 and a molecular weight of 154.16 g/mol. Its IUPAC name is 3,4a,5,6-tetrahydro-2H-1,4-benzodioxin-7-one.
| Compound Name | 3,4a,5,6-tetrahydro-2H-1,4-benzodioxin-7-one |
|---|---|
| PubChem CID | 139670653 |
| Molecular Formula | C8H10O3 |
| Molecular Weight | 154.16 g/mol |
| Exact Mass | 154.06 |
| IUPAC Name | 3,4a,5,6-tetrahydro-2H-1,4-benzodioxin-7-one |
| SMILES | O=C1C=C2OCCOC2CC1 |
| InChI | InChI=1S/C8H10O3/c9-6-1-2-7-8(5-6)11-4-3-10-7/h5,7H,1-4H2 |
| InChIKey | BVZMECZGRWQZQS-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.16 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |