C20H22O11 — CID 139671078
5-(5,6-dicarboxy-1-ethoxycyclohexa-2,4-dien-1-yl)oxy-5-ethoxycyclohexa-1,3-diene-1,2-dicarboxylic acid (PubChem CID 139671078) has the molecular formula C20H22O11 and a molecular weight of 438.39 g/mol. Its IUPAC name is 5-(5,6-dicarboxy-1-ethoxycyclohexa-2,4-dien-1-yl)oxy-5-ethoxycyclohexa-1,3-diene-1,2-dicarboxylic acid.
| Compound Name | 5-(5,6-dicarboxy-1-ethoxycyclohexa-2,4-dien-1-yl)oxy-5-ethoxycyclohexa-1,3-diene-1,2-dicarboxylic acid |
|---|---|
| PubChem CID | 139671078 |
| Molecular Formula | C20H22O11 |
| Molecular Weight | 438.39 g/mol |
| Exact Mass | 438.12 |
| IUPAC Name | 5-(5,6-dicarboxy-1-ethoxycyclohexa-2,4-dien-1-yl)oxy-5-ethoxycyclohexa-1,3-diene-1,2-dicarboxylic acid |
| SMILES | CCOC1(OC2(OCC)C=CC=C(C(=O)O)C2C(=O)O)C=CC(C(=O)O)=C(C(=O)O)C1 |
| InChI | InChI=1S/C20H22O11/c1-3-29-19(9-7-11(15(21)22)13(10-19)17(25)26)31-20(30-4-2)8-5-6-12(16(23)24)14(20)18(27)28/h5-9,14H,3-4,10H2,1-2H3,(H,21,22)(H,23,24)(H,25,26)(H,27,28) |
| InChIKey | BNIQOMJKUGJEJC-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 176.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.39 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|