C12H8F14O — CID 139671200
1,1,1,3-tetrafluoro-4-[3,5,5,5-tetrafluoro-4-(trifluoromethyl)pent-3-en-2-yl]oxy-2-(trifluoromethyl)pent-2-ene (PubChem CID 139671200) has the molecular formula C12H8F14O and a molecular weight of 434.17 g/mol. Its IUPAC name is 1,1,1,3-tetrafluoro-4-[3,5,5,5-tetrafluoro-4-(trifluoromethyl)pent-3-en-2-yl]oxy-2-(trifluoromethyl)pent-2-ene.
| Compound Name | 1,1,1,3-tetrafluoro-4-[3,5,5,5-tetrafluoro-4-(trifluoromethyl)pent-3-en-2-yl]oxy-2-(trifluoromethyl)pent-2-ene |
|---|---|
| PubChem CID | 139671200 |
| Molecular Formula | C12H8F14O |
| Molecular Weight | 434.17 g/mol |
| Exact Mass | 434.04 |
| IUPAC Name | 1,1,1,3-tetrafluoro-4-[3,5,5,5-tetrafluoro-4-(trifluoromethyl)pent-3-en-2-yl]oxy-2-(trifluoromethyl)pent-2-ene |
| SMILES | CC(OC(C)C(F)=C(C(F)(F)F)C(F)(F)F)C(F)=C(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C12H8F14O/c1-3(5(13)7(9(15,16)17)10(18,19)20)27-4(2)6(14)8(11(21,22)23)12(24,25)26/h3-4H,1-2H3 |
| InChIKey | IBMPANUIDMCVRJ-UHFFFAOYSA-N |
| XLogP | 6.48 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.17 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |