C23H29F3O8 — CID 139671291
diethyl 4-[1,3-bis[(2-methylpropan-2-yl)oxy]-1,3-dioxopropan-2-yl]-3,5,6-trifluorobenzene-1,2-dicarboxylate (PubChem CID 139671291) has the molecular formula C23H29F3O8 and a molecular weight of 490.47 g/mol. Its IUPAC name is diethyl 4-[1,3-bis[(2-methylpropan-2-yl)oxy]-1,3-dioxopropan-2-yl]-3,5,6-trifluorobenzene-1,2-dicarboxylate.
| Compound Name | diethyl 4-[1,3-bis[(2-methylpropan-2-yl)oxy]-1,3-dioxopropan-2-yl]-3,5,6-trifluorobenzene-1,2-dicarboxylate |
|---|---|
| PubChem CID | 139671291 |
| Molecular Formula | C23H29F3O8 |
| Molecular Weight | 490.47 g/mol |
| Exact Mass | 490.18 |
| IUPAC Name | diethyl 4-[1,3-bis[(2-methylpropan-2-yl)oxy]-1,3-dioxopropan-2-yl]-3,5,6-trifluorobenzene-1,2-dicarboxylate |
| SMILES | CCOC(=O)c1c(F)c(F)c(C(C(=O)OC(C)(C)C)C(=O)OC(C)(C)C)c(F)c1C(=O)OCC |
| InChI | InChI=1S/C23H29F3O8/c1-9-31-18(27)12-13(19(28)32-10-2)17(26)16(25)11(15(12)24)14(20(29)33-22(3,4)5)21(30)34-23(6,7)8/h14H,9-10H2,1-8H3 |
| InChIKey | WPGPZDSVOLUKNL-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.47 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|