C9H5Cl3N2S3 — CID 139671640
5-[(2,4,6-trichlorophenyl)methylsulfanyl]-3H-1,3,4-thiadiazole-2-thione (PubChem CID 139671640) has the molecular formula C9H5Cl3N2S3 and a molecular weight of 343.71 g/mol. Its IUPAC name is 5-[(2,4,6-trichlorophenyl)methylsulfanyl]-3H-1,3,4-thiadiazole-2-thione.
| Compound Name | 5-[(2,4,6-trichlorophenyl)methylsulfanyl]-3H-1,3,4-thiadiazole-2-thione |
|---|---|
| PubChem CID | 139671640 |
| Molecular Formula | C9H5Cl3N2S3 |
| Molecular Weight | 343.71 g/mol |
| Exact Mass | 341.87 |
| IUPAC Name | 5-[(2,4,6-trichlorophenyl)methylsulfanyl]-3H-1,3,4-thiadiazole-2-thione |
| SMILES | S=c1[nH]nc(SCc2c(Cl)cc(Cl)cc2Cl)s1 |
| InChI | InChI=1S/C9H5Cl3N2S3/c10-4-1-6(11)5(7(12)2-4)3-16-9-14-13-8(15)17-9/h1-2H,3H2,(H,13,15) |
| InChIKey | YYEGPZYGSRYEKP-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.71 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|