C28H38O3 — CID 139671708
(5'R,8'S,10'S,13'S,14'S)-13'-methyl-10'-[(4-methylphenyl)methyl]spiro[1,3-dioxolane-2,3'-2,4,6,7,8,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthrene]-5'-ol (PubChem CID 139671708) has the molecular formula C28H38O3 and a molecular weight of 422.61 g/mol. Its IUPAC name is (5'R,8'S,10'S,13'S,14'S)-13'-methyl-10'-[(4-methylphenyl)methyl]spiro[1,3-dioxolane-2,3'-2,4,6,7,8,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthrene]-5'-ol.
| Compound Name | (5'R,8'S,10'S,13'S,14'S)-13'-methyl-10'-[(4-methylphenyl)methyl]spiro[1,3-dioxolane-2,3'-2,4,6,7,8,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthrene]-5'-ol |
|---|---|
| PubChem CID | 139671708 |
| Molecular Formula | C28H38O3 |
| Molecular Weight | 422.61 g/mol |
| Exact Mass | 422.28 |
| IUPAC Name | (5'R,8'S,10'S,13'S,14'S)-13'-methyl-10'-[(4-methylphenyl)methyl]spiro[1,3-dioxolane-2,3'-2,4,6,7,8,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthrene]-5'-ol |
| SMILES | Cc1ccc(C[C@]23CCC4(C[C@]2(O)CC[C@@H]2C3=CC[C@]3(C)CCC[C@@H]23)OCCO4)cc1 |
| InChI | InChI=1S/C28H38O3/c1-20-5-7-21(8-6-20)18-26-14-15-28(30-16-17-31-28)19-27(26,29)13-9-22-23-4-3-11-25(23,2)12-10-24(22)26/h5-8,10,22-23,29H,3-4,9,11-19H2,1-2H3/t22-,23-,25-,26-,27+/m0/s1 |
| InChIKey | YXSAKMVXYAVFIY-MESUCIAJSA-N |
| XLogP | 5.73 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.61 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|