About 2-pent-4-enoxy-4,6-bis(prop-2-enyl)pyridine
2-pent-4-enoxy-4,6-bis(prop-2-enyl)pyridine (PubChem CID 139671893) has the molecular formula C16H21NO
and a molecular weight of 243.35 g/mol. Its IUPAC name is 2-pent-4-enoxy-4,6-bis(prop-2-enyl)pyridine.
Molecular Properties
| Compound Name | 2-pent-4-enoxy-4,6-bis(prop-2-enyl)pyridine |
| PubChem CID | 139671893 |
| Molecular Formula | C16H21NO |
| Molecular Weight | 243.35 g/mol |
| Exact Mass | 243.16 |
| IUPAC Name | 2-pent-4-enoxy-4,6-bis(prop-2-enyl)pyridine |
| SMILES | C=CCCCOc1cc(CC=C)cc(CC=C)n1 |
| InChI | InChI=1S/C16H21NO/c1-4-7-8-11-18-16-13-14(9-5-2)12-15(17-16)10-6-3/h4-6,12-13H,1-3,7-11H2 |
| InChIKey | MSSBUKBIMJOZHO-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.35 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-pent-4-enoxy-4,6-bis(prop-2-enyl)pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-pent-4-enoxy-4,6-bis(prop-2-enyl)pyridine?
The IUPAC name of 2-pent-4-enoxy-4,6-bis(prop-2-enyl)pyridine (CID 139671893) is 2-pent-4-enoxy-4,6-bis(prop-2-enyl)pyridine.
What is the SMILES notation for 2-pent-4-enoxy-4,6-bis(prop-2-enyl)pyridine?
The canonical SMILES for 2-pent-4-enoxy-4,6-bis(prop-2-enyl)pyridine is C=CCCCOc1cc(CC=C)cc(CC=C)n1.
What is the InChIKey of 2-pent-4-enoxy-4,6-bis(prop-2-enyl)pyridine?
The InChIKey is MSSBUKBIMJOZHO-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H21NO/c1-4-7-8-11-18-16-13-14(9-5-2)12-15(17-16)10-6-3/h4-6,12-13H,1-3,7-11H2.
What are the key properties of 2-pent-4-enoxy-4,6-bis(prop-2-enyl)pyridine?
2-pent-4-enoxy-4,6-bis(prop-2-enyl)pyridine has a molecular weight of 243.35 g/mol, XLogP of 3.88, 9 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-pent-4-enoxy-4,6-bis(prop-2-enyl)pyridine is sourced from PubChem (CID 139671893), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).