C12H15N3S4 — CID 139672184
3-imino-4,5,6,7-tetrakis(methylsulfanyl)isoindol-1-amine (PubChem CID 139672184) has the molecular formula C12H15N3S4 and a molecular weight of 329.54 g/mol. Its IUPAC name is 3-imino-4,5,6,7-tetrakis(methylsulfanyl)isoindol-1-amine.
| Compound Name | 3-imino-4,5,6,7-tetrakis(methylsulfanyl)isoindol-1-amine |
|---|---|
| PubChem CID | 139672184 |
| Molecular Formula | C12H15N3S4 |
| Molecular Weight | 329.54 g/mol |
| Exact Mass | 329.01 |
| IUPAC Name | 3-imino-4,5,6,7-tetrakis(methylsulfanyl)isoindol-1-amine |
| SMILES | [H]/N=C1\N=C(N)c2c(SC)c(SC)c(SC)c(SC)c21 |
| InChI | InChI=1S/C12H15N3S4/c1-16-7-5-6(12(14)15-11(5)13)8(17-2)10(19-4)9(7)18-3/h1-4H3,(H3,13,14,15) |
| InChIKey | LJMQPRLFUOARJE-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 62.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.54 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|