About di(propan-2-yl)-bis(2-propan-2-yl-4-triethylsilylcyclopenta-2,4-dien-1-yl)silane
di(propan-2-yl)-bis(2-propan-2-yl-4-triethylsilylcyclopenta-2,4-dien-1-yl)silane (PubChem CID 139672565) has the molecular formula C34H64Si3
and a molecular weight of 557.14 g/mol. Its IUPAC name is di(propan-2-yl)-bis(2-propan-2-yl-4-triethylsilylcyclopenta-2,4-dien-1-yl)silane.
Molecular Properties
| Compound Name | di(propan-2-yl)-bis(2-propan-2-yl-4-triethylsilylcyclopenta-2,4-dien-1-yl)silane |
| PubChem CID | 139672565 |
| Molecular Formula | C34H64Si3 |
| Molecular Weight | 557.14 g/mol |
| Exact Mass | 556.43 |
| IUPAC Name | di(propan-2-yl)-bis(2-propan-2-yl-4-triethylsilylcyclopenta-2,4-dien-1-yl)silane |
| SMILES | CC[Si](CC)(CC)C1=CC([Si](C(C)C)(C(C)C)C2C=C([Si](CC)(CC)CC)C=C2C(C)C)C(C(C)C)=C1 |
| InChI | InChI=1S/C34H64Si3/c1-15-35(16-2,17-3)29-21-31(25(7)8)33(23-29)37(27(11)12,28(13)14)34-24-30(22-32(34)26(9)10)36(18-4,19-5)20-6/h21-28,33-34H,15-20H2,1-14H3 |
| InChIKey | OZEBDYUOKSFOFT-UHFFFAOYSA-N |
| XLogP | 12.14 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 557.14 |
| LogP ≤ 5 | 12.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze di(propan-2-yl)-bis(2-propan-2-yl-4-triethylsilylcyclopenta-2,4-dien-1-yl)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of di(propan-2-yl)-bis(2-propan-2-yl-4-triethylsilylcyclopenta-2,4-dien-1-yl)silane?
The IUPAC name of di(propan-2-yl)-bis(2-propan-2-yl-4-triethylsilylcyclopenta-2,4-dien-1-yl)silane (CID 139672565) is di(propan-2-yl)-bis(2-propan-2-yl-4-triethylsilylcyclopenta-2,4-dien-1-yl)silane.
What is the SMILES notation for di(propan-2-yl)-bis(2-propan-2-yl-4-triethylsilylcyclopenta-2,4-dien-1-yl)silane?
The canonical SMILES for di(propan-2-yl)-bis(2-propan-2-yl-4-triethylsilylcyclopenta-2,4-dien-1-yl)silane is CC[Si](CC)(CC)C1=CC([Si](C(C)C)(C(C)C)C2C=C([Si](CC)(CC)CC)C=C2C(C)C)C(C(C)C)=C1.
What is the InChIKey of di(propan-2-yl)-bis(2-propan-2-yl-4-triethylsilylcyclopenta-2,4-dien-1-yl)silane?
The InChIKey is OZEBDYUOKSFOFT-UHFFFAOYSA-N. The full InChI is InChI=1S/C34H64Si3/c1-15-35(16-2,17-3)29-21-31(25(7)8)33(23-29)37(27(11)12,28(13)14)34-24-30(22-32(34)26(9)10)36(18-4,19-5)20-6/h21-28,33-34H,15-20H2,1-14H3.
What are the key properties of di(propan-2-yl)-bis(2-propan-2-yl-4-triethylsilylcyclopenta-2,4-dien-1-yl)silane?
di(propan-2-yl)-bis(2-propan-2-yl-4-triethylsilylcyclopenta-2,4-dien-1-yl)silane has a molecular weight of 557.14 g/mol, XLogP of 12.14, 14 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for di(propan-2-yl)-bis(2-propan-2-yl-4-triethylsilylcyclopenta-2,4-dien-1-yl)silane is sourced from PubChem (CID 139672565), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).