About dimethyl-bis(2-propan-2-yl-4-triethylsilylcyclopenta-2,4-dien-1-yl)silane
dimethyl-bis(2-propan-2-yl-4-triethylsilylcyclopenta-2,4-dien-1-yl)silane (PubChem CID 139672567) has the molecular formula C30H56Si3
and a molecular weight of 501.04 g/mol. Its IUPAC name is dimethyl-bis(2-propan-2-yl-4-triethylsilylcyclopenta-2,4-dien-1-yl)silane.
Molecular Properties
| Compound Name | dimethyl-bis(2-propan-2-yl-4-triethylsilylcyclopenta-2,4-dien-1-yl)silane |
| PubChem CID | 139672567 |
| Molecular Formula | C30H56Si3 |
| Molecular Weight | 501.04 g/mol |
| Exact Mass | 500.37 |
| IUPAC Name | dimethyl-bis(2-propan-2-yl-4-triethylsilylcyclopenta-2,4-dien-1-yl)silane |
| SMILES | CC[Si](CC)(CC)C1=CC([Si](C)(C)C2C=C([Si](CC)(CC)CC)C=C2C(C)C)C(C(C)C)=C1 |
| InChI | InChI=1S/C30H56Si3/c1-13-32(14-2,15-3)25-19-27(23(7)8)29(21-25)31(11,12)30-22-26(20-28(30)24(9)10)33(16-4,17-5)18-6/h19-24,29-30H,13-18H2,1-12H3 |
| InChIKey | LRBCQPJUWPNMQM-UHFFFAOYSA-N |
| XLogP | 10.58 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 501.04 |
| LogP ≤ 5 | 10.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze dimethyl-bis(2-propan-2-yl-4-triethylsilylcyclopenta-2,4-dien-1-yl)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethyl-bis(2-propan-2-yl-4-triethylsilylcyclopenta-2,4-dien-1-yl)silane?
The IUPAC name of dimethyl-bis(2-propan-2-yl-4-triethylsilylcyclopenta-2,4-dien-1-yl)silane (CID 139672567) is dimethyl-bis(2-propan-2-yl-4-triethylsilylcyclopenta-2,4-dien-1-yl)silane.
What is the SMILES notation for dimethyl-bis(2-propan-2-yl-4-triethylsilylcyclopenta-2,4-dien-1-yl)silane?
The canonical SMILES for dimethyl-bis(2-propan-2-yl-4-triethylsilylcyclopenta-2,4-dien-1-yl)silane is CC[Si](CC)(CC)C1=CC([Si](C)(C)C2C=C([Si](CC)(CC)CC)C=C2C(C)C)C(C(C)C)=C1.
What is the InChIKey of dimethyl-bis(2-propan-2-yl-4-triethylsilylcyclopenta-2,4-dien-1-yl)silane?
The InChIKey is LRBCQPJUWPNMQM-UHFFFAOYSA-N. The full InChI is InChI=1S/C30H56Si3/c1-13-32(14-2,15-3)25-19-27(23(7)8)29(21-25)31(11,12)30-22-26(20-28(30)24(9)10)33(16-4,17-5)18-6/h19-24,29-30H,13-18H2,1-12H3.
What are the key properties of dimethyl-bis(2-propan-2-yl-4-triethylsilylcyclopenta-2,4-dien-1-yl)silane?
dimethyl-bis(2-propan-2-yl-4-triethylsilylcyclopenta-2,4-dien-1-yl)silane has a molecular weight of 501.04 g/mol, XLogP of 10.58, 12 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for dimethyl-bis(2-propan-2-yl-4-triethylsilylcyclopenta-2,4-dien-1-yl)silane is sourced from PubChem (CID 139672567), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).