C36H48Si — CID 139672616
di(butan-2-yl)-bis(4-phenyl-2-propan-2-ylcyclopenta-2,4-dien-1-yl)silane (PubChem CID 139672616) has the molecular formula C36H48Si and a molecular weight of 508.87 g/mol. Its IUPAC name is di(butan-2-yl)-bis(4-phenyl-2-propan-2-ylcyclopenta-2,4-dien-1-yl)silane.
| Compound Name | di(butan-2-yl)-bis(4-phenyl-2-propan-2-ylcyclopenta-2,4-dien-1-yl)silane |
|---|---|
| PubChem CID | 139672616 |
| Molecular Formula | C36H48Si |
| Molecular Weight | 508.87 g/mol |
| Exact Mass | 508.35 |
| IUPAC Name | di(butan-2-yl)-bis(4-phenyl-2-propan-2-ylcyclopenta-2,4-dien-1-yl)silane |
| SMILES | CCC(C)[Si](C(C)CC)(C1C=C(c2ccccc2)C=C1C(C)C)C1C=C(c2ccccc2)C=C1C(C)C |
| InChI | InChI=1S/C36H48Si/c1-9-27(7)37(28(8)10-2,35-23-31(21-33(35)25(3)4)29-17-13-11-14-18-29)36-24-32(22-34(36)26(5)6)30-19-15-12-16-20-30/h11-28,35-36H,9-10H2,1-8H3 |
| InChIKey | CPHCJMFCPSELLS-UHFFFAOYSA-N |
| XLogP | 11.14 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.87 |
| LogP ≤ 5 | 11.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|