C16H10Cl4N2O2 — CID 139672848
2-[(4-amino-3-methylphenyl)methyl]-4,5,6,7-tetrachloroisoindole-1,3-dione (PubChem CID 139672848) has the molecular formula C16H10Cl4N2O2 and a molecular weight of 404.08 g/mol. Its IUPAC name is 2-[(4-amino-3-methylphenyl)methyl]-4,5,6,7-tetrachloroisoindole-1,3-dione.
| Compound Name | 2-[(4-amino-3-methylphenyl)methyl]-4,5,6,7-tetrachloroisoindole-1,3-dione |
|---|---|
| PubChem CID | 139672848 |
| Molecular Formula | C16H10Cl4N2O2 |
| Molecular Weight | 404.08 g/mol |
| Exact Mass | 401.95 |
| IUPAC Name | 2-[(4-amino-3-methylphenyl)methyl]-4,5,6,7-tetrachloroisoindole-1,3-dione |
| SMILES | Cc1cc(CN2C(=O)c3c(Cl)c(Cl)c(Cl)c(Cl)c3C2=O)ccc1N |
| InChI | InChI=1S/C16H10Cl4N2O2/c1-6-4-7(2-3-8(6)21)5-22-15(23)9-10(16(22)24)12(18)14(20)13(19)11(9)17/h2-4H,5,21H2,1H3 |
| InChIKey | JZNNGFDREBOOFJ-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.08 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|