C16H8Cl3N3 — CID 139674026
4-chloro-1,5-bis(2-chlorophenyl)pyrazole-3-carbonitrile (PubChem CID 139674026) has the molecular formula C16H8Cl3N3 and a molecular weight of 348.62 g/mol. Its IUPAC name is 4-chloro-1,5-bis(2-chlorophenyl)pyrazole-3-carbonitrile.
| Compound Name | 4-chloro-1,5-bis(2-chlorophenyl)pyrazole-3-carbonitrile |
|---|---|
| PubChem CID | 139674026 |
| Molecular Formula | C16H8Cl3N3 |
| Molecular Weight | 348.62 g/mol |
| Exact Mass | 346.98 |
| IUPAC Name | 4-chloro-1,5-bis(2-chlorophenyl)pyrazole-3-carbonitrile |
| SMILES | N#Cc1nn(-c2ccccc2Cl)c(-c2ccccc2Cl)c1Cl |
| InChI | InChI=1S/C16H8Cl3N3/c17-11-6-2-1-5-10(11)16-15(19)13(9-20)21-22(16)14-8-4-3-7-12(14)18/h1-8H |
| InChIKey | DKOVIVHIFHULFX-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 41.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.62 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |