C19H22N4O4S — CID 139674760
(2Z)-2-amino-2-[4-methylsulfonyl-1-(2-phenylphenyl)piperazin-2-yl]iminoacetic acid (PubChem CID 139674760) has the molecular formula C19H22N4O4S and a molecular weight of 402.48 g/mol. Its IUPAC name is (2Z)-2-amino-2-[4-methylsulfonyl-1-(2-phenylphenyl)piperazin-2-yl]iminoacetic acid.
| Compound Name | (2Z)-2-amino-2-[4-methylsulfonyl-1-(2-phenylphenyl)piperazin-2-yl]iminoacetic acid |
|---|---|
| PubChem CID | 139674760 |
| Molecular Formula | C19H22N4O4S |
| Molecular Weight | 402.48 g/mol |
| Exact Mass | 402.14 |
| IUPAC Name | (2Z)-2-amino-2-[4-methylsulfonyl-1-(2-phenylphenyl)piperazin-2-yl]iminoacetic acid |
| SMILES | CS(=O)(=O)N1CCN(c2ccccc2-c2ccccc2)C(/N=C(\N)C(=O)O)C1 |
| InChI | InChI=1S/C19H22N4O4S/c1-28(26,27)22-11-12-23(17(13-22)21-18(20)19(24)25)16-10-6-5-9-15(16)14-7-3-2-4-8-14/h2-10,17H,11-13H2,1H3,(H2,20,21)(H,24,25) |
| InChIKey | FTFDYIRKESWERI-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 116.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.48 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|