C11H2F8N2O — CID 139675028
1-(2,3,4,5,6-pentafluorophenyl)-3-(trifluoromethyl)pyrazole-4-carbaldehyde (PubChem CID 139675028) has the molecular formula C11H2F8N2O and a molecular weight of 330.13 g/mol. Its IUPAC name is 1-(2,3,4,5,6-pentafluorophenyl)-3-(trifluoromethyl)pyrazole-4-carbaldehyde.
| Compound Name | 1-(2,3,4,5,6-pentafluorophenyl)-3-(trifluoromethyl)pyrazole-4-carbaldehyde |
|---|---|
| PubChem CID | 139675028 |
| Molecular Formula | C11H2F8N2O |
| Molecular Weight | 330.13 g/mol |
| Exact Mass | 330.00 |
| IUPAC Name | 1-(2,3,4,5,6-pentafluorophenyl)-3-(trifluoromethyl)pyrazole-4-carbaldehyde |
| SMILES | O=Cc1cn(-c2c(F)c(F)c(F)c(F)c2F)nc1C(F)(F)F |
| InChI | InChI=1S/C11H2F8N2O/c12-4-5(13)7(15)9(8(16)6(4)14)21-1-3(2-22)10(20-21)11(17,18)19/h1-2H |
| InChIKey | RPLGICIHTUUWRH-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.13 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|