C30H30BrNO10 — CID 139675997
(3E,4S)-3-[[2-bromo-4,5-dimethoxy-3-[(4-nitrophenyl)methoxy]phenyl]methylidene]-4-[(3,4,5-trimethoxyphenyl)methyl]oxolan-2-one (PubChem CID 139675997) has the molecular formula C30H30BrNO10 and a molecular weight of 644.47 g/mol. Its IUPAC name is (3E,4S)-3-[[2-bromo-4,5-dimethoxy-3-[(4-nitrophenyl)methoxy]phenyl]methylidene]-4-[(3,4,5-trimethoxyphenyl)methyl]oxolan-2-one.
| Compound Name | (3E,4S)-3-[[2-bromo-4,5-dimethoxy-3-[(4-nitrophenyl)methoxy]phenyl]methylidene]-4-[(3,4,5-trimethoxyphenyl)methyl]oxolan-2-one |
|---|---|
| PubChem CID | 139675997 |
| Molecular Formula | C30H30BrNO10 |
| Molecular Weight | 644.47 g/mol |
| Exact Mass | 643.11 |
| IUPAC Name | (3E,4S)-3-[[2-bromo-4,5-dimethoxy-3-[(4-nitrophenyl)methoxy]phenyl]methylidene]-4-[(3,4,5-trimethoxyphenyl)methyl]oxolan-2-one |
| SMILES | COc1cc(C[C@@H]2COC(=O)/C2=C/c2cc(OC)c(OC)c(OCc3ccc([N+](=O)[O-])cc3)c2Br)cc(OC)c1OC |
| InChI | InChI=1S/C30H30BrNO10/c1-36-23-11-18(12-24(37-2)27(23)39-4)10-20-16-42-30(33)22(20)13-19-14-25(38-3)28(40-5)29(26(19)31)41-15-17-6-8-21(9-7-17)32(34)35/h6-9,11-14,20H,10,15-16H2,1-5H3/b22-13+/t20-/m1/s1 |
| InChIKey | NOKNSADSSQSLHW-CCULFSDZSA-N |
| XLogP | 5.78 |
| TPSA | 124.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.47 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|