C26H32FN3OS — CID 139676498
3-[4-[4-(6-fluoro-1-benzothiophen-3-yl)piperidin-1-yl]butyl]-2-methyl-5,6,7,8-tetrahydroquinazolin-4-one (PubChem CID 139676498) has the molecular formula C26H32FN3OS and a molecular weight of 453.63 g/mol. Its IUPAC name is 3-[4-[4-(6-fluoro-1-benzothiophen-3-yl)piperidin-1-yl]butyl]-2-methyl-5,6,7,8-tetrahydroquinazolin-4-one.
| Compound Name | 3-[4-[4-(6-fluoro-1-benzothiophen-3-yl)piperidin-1-yl]butyl]-2-methyl-5,6,7,8-tetrahydroquinazolin-4-one |
|---|---|
| PubChem CID | 139676498 |
| Molecular Formula | C26H32FN3OS |
| Molecular Weight | 453.63 g/mol |
| Exact Mass | 453.23 |
| IUPAC Name | 3-[4-[4-(6-fluoro-1-benzothiophen-3-yl)piperidin-1-yl]butyl]-2-methyl-5,6,7,8-tetrahydroquinazolin-4-one |
| SMILES | Cc1nc2c(c(=O)n1CCCCN1CCC(c3csc4cc(F)ccc34)CC1)CCCC2 |
| InChI | InChI=1S/C26H32FN3OS/c1-18-28-24-7-3-2-6-22(24)26(31)30(18)13-5-4-12-29-14-10-19(11-15-29)23-17-32-25-16-20(27)8-9-21(23)25/h8-9,16-17,19H,2-7,10-15H2,1H3 |
| InChIKey | FUGGQGPQICKAAD-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.63 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|