About 2H-pyrano[3,2-c]pyridine;hydrochloride
2H-pyrano[3,2-c]pyridine;hydrochloride (PubChem CID 139676517) has the molecular formula C8H8ClNO
and a molecular weight of 169.61 g/mol. Its IUPAC name is 2H-pyrano[3,2-c]pyridine;hydrochloride.
Molecular Properties
| Compound Name | 2H-pyrano[3,2-c]pyridine;hydrochloride |
| PubChem CID | 139676517 |
| Molecular Formula | C8H8ClNO |
| Molecular Weight | 169.61 g/mol |
| Exact Mass | 169.03 |
| IUPAC Name | 2H-pyrano[3,2-c]pyridine;hydrochloride |
| SMILES | C1=Cc2cnccc2OC1.Cl |
| InChI | InChI=1S/C8H7NO.ClH/c1-2-7-6-9-4-3-8(7)10-5-1;/h1-4,6H,5H2;1H |
| InChIKey | XRLKVYFFTHGORZ-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.61 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2H-pyrano[3,2-c]pyridine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2H-pyrano[3,2-c]pyridine;hydrochloride?
The IUPAC name of 2H-pyrano[3,2-c]pyridine;hydrochloride (CID 139676517) is 2H-pyrano[3,2-c]pyridine;hydrochloride.
What is the SMILES notation for 2H-pyrano[3,2-c]pyridine;hydrochloride?
The canonical SMILES for 2H-pyrano[3,2-c]pyridine;hydrochloride is C1=Cc2cnccc2OC1.Cl.
What is the InChIKey of 2H-pyrano[3,2-c]pyridine;hydrochloride?
The InChIKey is XRLKVYFFTHGORZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7NO.ClH/c1-2-7-6-9-4-3-8(7)10-5-1;/h1-4,6H,5H2;1H.
What are the key properties of 2H-pyrano[3,2-c]pyridine;hydrochloride?
2H-pyrano[3,2-c]pyridine;hydrochloride has a molecular weight of 169.61 g/mol, XLogP of 1.91, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2H-pyrano[3,2-c]pyridine;hydrochloride is sourced from PubChem (CID 139676517), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).