About 2-chloro-3-nitrobenzoyl bromide
2-chloro-3-nitrobenzoyl bromide (PubChem CID 139677086) has the molecular formula C7H3BrClNO3
and a molecular weight of 264.46 g/mol. Its IUPAC name is 2-chloro-3-nitrobenzoyl bromide.
Molecular Properties
| Compound Name | 2-chloro-3-nitrobenzoyl bromide |
| PubChem CID | 139677086 |
| Molecular Formula | C7H3BrClNO3 |
| Molecular Weight | 264.46 g/mol |
| Exact Mass | 262.90 |
| IUPAC Name | 2-chloro-3-nitrobenzoyl bromide |
| SMILES | O=C(Br)c1cccc([N+](=O)[O-])c1Cl |
| InChI | InChI=1S/C7H3BrClNO3/c8-7(11)4-2-1-3-5(6(4)9)10(12)13/h1-3H |
| InChIKey | GAERWXUOKDMVHA-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 60.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.46 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-chloro-3-nitrobenzoyl bromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-3-nitrobenzoyl bromide?
The IUPAC name of 2-chloro-3-nitrobenzoyl bromide (CID 139677086) is 2-chloro-3-nitrobenzoyl bromide.
What is the SMILES notation for 2-chloro-3-nitrobenzoyl bromide?
The canonical SMILES for 2-chloro-3-nitrobenzoyl bromide is O=C(Br)c1cccc([N+](=O)[O-])c1Cl.
What is the InChIKey of 2-chloro-3-nitrobenzoyl bromide?
The InChIKey is GAERWXUOKDMVHA-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H3BrClNO3/c8-7(11)4-2-1-3-5(6(4)9)10(12)13/h1-3H.
What are the key properties of 2-chloro-3-nitrobenzoyl bromide?
2-chloro-3-nitrobenzoyl bromide has a molecular weight of 264.46 g/mol, XLogP of 2.78, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-3-nitrobenzoyl bromide is sourced from PubChem (CID 139677086), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).