C14H15NO4S — CID 139677404
1,2,6-trimethyl-4-thiophen-2-yl-4H-pyridine-3,5-dicarboxylic acid (PubChem CID 139677404) has the molecular formula C14H15NO4S and a molecular weight of 293.34 g/mol. Its IUPAC name is 1,2,6-trimethyl-4-thiophen-2-yl-4H-pyridine-3,5-dicarboxylic acid.
| Compound Name | 1,2,6-trimethyl-4-thiophen-2-yl-4H-pyridine-3,5-dicarboxylic acid |
|---|---|
| PubChem CID | 139677404 |
| Molecular Formula | C14H15NO4S |
| Molecular Weight | 293.34 g/mol |
| Exact Mass | 293.07 |
| IUPAC Name | 1,2,6-trimethyl-4-thiophen-2-yl-4H-pyridine-3,5-dicarboxylic acid |
| SMILES | CC1=C(C(=O)O)C(c2cccs2)C(C(=O)O)=C(C)N1C |
| InChI | InChI=1S/C14H15NO4S/c1-7-10(13(16)17)12(9-5-4-6-20-9)11(14(18)19)8(2)15(7)3/h4-6,12H,1-3H3,(H,16,17)(H,18,19) |
| InChIKey | ZSEUFBRZYNCQRJ-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.34 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |