C12H21N5O4 — CID 139678421
N,N-dimethyl-2-nitroimino-3-(oxolan-3-ylmethyl)-1,3-diazinane-1-carboxamide (PubChem CID 139678421) has the molecular formula C12H21N5O4 and a molecular weight of 299.33 g/mol. Its IUPAC name is N,N-dimethyl-2-nitroimino-3-(oxolan-3-ylmethyl)-1,3-diazinane-1-carboxamide.
| Compound Name | N,N-dimethyl-2-nitroimino-3-(oxolan-3-ylmethyl)-1,3-diazinane-1-carboxamide |
|---|---|
| PubChem CID | 139678421 |
| Molecular Formula | C12H21N5O4 |
| Molecular Weight | 299.33 g/mol |
| Exact Mass | 299.16 |
| IUPAC Name | N,N-dimethyl-2-nitroimino-3-(oxolan-3-ylmethyl)-1,3-diazinane-1-carboxamide |
| SMILES | CN(C)C(=O)N1CCCN(CC2CCOC2)C1=N[N+](=O)[O-] |
| InChI | InChI=1S/C12H21N5O4/c1-14(2)12(18)16-6-3-5-15(11(16)13-17(19)20)8-10-4-7-21-9-10/h10H,3-9H2,1-2H3 |
| InChIKey | RMGIIMAWQFVLGC-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 91.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.33 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|