C15H17BrN4O5 — CID 139678614
(4-bromophenyl) 2-nitroimino-3-(oxolan-3-ylmethyl)imidazolidine-1-carboxylate (PubChem CID 139678614) has the molecular formula C15H17BrN4O5 and a molecular weight of 413.23 g/mol. Its IUPAC name is (4-bromophenyl) 2-nitroimino-3-(oxolan-3-ylmethyl)imidazolidine-1-carboxylate.
| Compound Name | (4-bromophenyl) 2-nitroimino-3-(oxolan-3-ylmethyl)imidazolidine-1-carboxylate |
|---|---|
| PubChem CID | 139678614 |
| Molecular Formula | C15H17BrN4O5 |
| Molecular Weight | 413.23 g/mol |
| Exact Mass | 412.04 |
| IUPAC Name | (4-bromophenyl) 2-nitroimino-3-(oxolan-3-ylmethyl)imidazolidine-1-carboxylate |
| SMILES | O=C(Oc1ccc(Br)cc1)N1CCN(CC2CCOC2)C1=N[N+](=O)[O-] |
| InChI | InChI=1S/C15H17BrN4O5/c16-12-1-3-13(4-2-12)25-15(21)19-7-6-18(14(19)17-20(22)23)9-11-5-8-24-10-11/h1-4,11H,5-10H2 |
| InChIKey | BWCZBDXYXUVTSO-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 97.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.23 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|