C16H19N5O5 — CID 139678759
N-[1-[2-(2-nitrophenyl)ethenyl]-3-(oxolan-3-ylmethyl)imidazolidin-2-ylidene]nitramide (PubChem CID 139678759) has the molecular formula C16H19N5O5 and a molecular weight of 361.36 g/mol. Its IUPAC name is N-[1-[2-(2-nitrophenyl)ethenyl]-3-(oxolan-3-ylmethyl)imidazolidin-2-ylidene]nitramide.
| Compound Name | N-[1-[2-(2-nitrophenyl)ethenyl]-3-(oxolan-3-ylmethyl)imidazolidin-2-ylidene]nitramide |
|---|---|
| PubChem CID | 139678759 |
| Molecular Formula | C16H19N5O5 |
| Molecular Weight | 361.36 g/mol |
| Exact Mass | 361.14 |
| IUPAC Name | N-[1-[2-(2-nitrophenyl)ethenyl]-3-(oxolan-3-ylmethyl)imidazolidin-2-ylidene]nitramide |
| SMILES | O=[N+]([O-])N=C1N(C=Cc2ccccc2[N+](=O)[O-])CCN1CC1CCOC1 |
| InChI | InChI=1S/C16H19N5O5/c22-20(23)15-4-2-1-3-14(15)5-7-18-8-9-19(16(18)17-21(24)25)11-13-6-10-26-12-13/h1-5,7,13H,6,8-12H2 |
| InChIKey | XZXKKPRFBUXCJE-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 114.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.36 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|