About bis(morpholin-4-ylamino) sulfate
bis(morpholin-4-ylamino) sulfate (PubChem CID 139679191) has the molecular formula C8H18N4O6S
and a molecular weight of 298.32 g/mol. Its IUPAC name is bis(morpholin-4-ylamino) sulfate.
Molecular Properties
| Compound Name | bis(morpholin-4-ylamino) sulfate |
| PubChem CID | 139679191 |
| Molecular Formula | C8H18N4O6S |
| Molecular Weight | 298.32 g/mol |
| Exact Mass | 298.09 |
| IUPAC Name | bis(morpholin-4-ylamino) sulfate |
| SMILES | O=S(=O)(ONN1CCOCC1)ONN1CCOCC1 |
| InChI | InChI=1S/C8H18N4O6S/c13-19(14,17-9-11-1-5-15-6-2-11)18-10-12-3-7-16-8-4-12/h9-10H,1-8H2 |
| InChIKey | TUABLFIHLUBMSN-UHFFFAOYSA-N |
| XLogP | -2.23 |
| TPSA | 101.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.32 |
| LogP ≤ 5 | -2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze bis(morpholin-4-ylamino) sulfate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(morpholin-4-ylamino) sulfate?
The IUPAC name of bis(morpholin-4-ylamino) sulfate (CID 139679191) is bis(morpholin-4-ylamino) sulfate.
What is the SMILES notation for bis(morpholin-4-ylamino) sulfate?
The canonical SMILES for bis(morpholin-4-ylamino) sulfate is O=S(=O)(ONN1CCOCC1)ONN1CCOCC1.
What is the InChIKey of bis(morpholin-4-ylamino) sulfate?
The InChIKey is TUABLFIHLUBMSN-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H18N4O6S/c13-19(14,17-9-11-1-5-15-6-2-11)18-10-12-3-7-16-8-4-12/h9-10H,1-8H2.
What are the key properties of bis(morpholin-4-ylamino) sulfate?
bis(morpholin-4-ylamino) sulfate has a molecular weight of 298.32 g/mol, XLogP of -2.23, 6 rotatable bonds, 2 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for bis(morpholin-4-ylamino) sulfate is sourced from PubChem (CID 139679191), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).