C29H45FO16Si — CID 139679555
[(2R,3R,4S,5R,6R)-4,5-diacetyloxy-3-[(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-(fluoromethyl)oxan-2-yl]oxy-6-(2-trimethylsilylethoxy)oxan-2-yl]methyl acetate (PubChem CID 139679555) has the molecular formula C29H45FO16Si and a molecular weight of 696.75 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6R)-4,5-diacetyloxy-3-[(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-(fluoromethyl)oxan-2-yl]oxy-6-(2-trimethylsilylethoxy)oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4S,5R,6R)-4,5-diacetyloxy-3-[(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-(fluoromethyl)oxan-2-yl]oxy-6-(2-trimethylsilylethoxy)oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 139679555 |
| Molecular Formula | C29H45FO16Si |
| Molecular Weight | 696.75 g/mol |
| Exact Mass | 696.25 |
| IUPAC Name | [(2R,3R,4S,5R,6R)-4,5-diacetyloxy-3-[(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-(fluoromethyl)oxan-2-yl]oxy-6-(2-trimethylsilylethoxy)oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H](OCC[Si](C)(C)C)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1O[C@@H]1O[C@H](CF)[C@H](OC(C)=O)[C@H](OC(C)=O)[C@H]1OC(C)=O |
| InChI | InChI=1S/C29H45FO16Si/c1-14(31)38-13-21-23(25(41-17(4)34)26(42-18(5)35)28(45-21)37-10-11-47(7,8)9)46-29-27(43-19(6)36)24(40-16(3)33)22(39-15(2)32)20(12-30)44-29/h20-29H,10-13H2,1-9H3/t20-,21-,22+,23-,24+,25+,26-,27-,28-,29+/m1/s1 |
| InChIKey | UTTLLOWACVISSV-IEXBOCDTSA-N |
| XLogP | 1.37 |
| TPSA | 194.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 696.75 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|