About 2-[(E)-1,2-difluoro-2-(4-propylcyclohexyl)ethenyl]-5-propylpyrimidine
2-[(E)-1,2-difluoro-2-(4-propylcyclohexyl)ethenyl]-5-propylpyrimidine (PubChem CID 139679897) has the molecular formula C18H26F2N2
and a molecular weight of 308.42 g/mol. Its IUPAC name is 2-[(E)-1,2-difluoro-2-(4-propylcyclohexyl)ethenyl]-5-propylpyrimidine.
Molecular Properties
| Compound Name | 2-[(E)-1,2-difluoro-2-(4-propylcyclohexyl)ethenyl]-5-propylpyrimidine |
| PubChem CID | 139679897 |
| Molecular Formula | C18H26F2N2 |
| Molecular Weight | 308.42 g/mol |
| Exact Mass | 308.21 |
| IUPAC Name | 2-[(E)-1,2-difluoro-2-(4-propylcyclohexyl)ethenyl]-5-propylpyrimidine |
| SMILES | CCCc1cnc(/C(F)=C(\F)C2CCC(CCC)CC2)nc1 |
| InChI | InChI=1S/C18H26F2N2/c1-3-5-13-7-9-15(10-8-13)16(19)17(20)18-21-11-14(6-4-2)12-22-18/h11-13,15H,3-10H2,1-2H3/b17-16+ |
| InChIKey | IPIQOQXOLIYGHZ-WUKNDPDISA-N |
| XLogP | 5.64 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 308.42 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-[(E)-1,2-difluoro-2-(4-propylcyclohexyl)ethenyl]-5-propylpyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(E)-1,2-difluoro-2-(4-propylcyclohexyl)ethenyl]-5-propylpyrimidine?
The IUPAC name of 2-[(E)-1,2-difluoro-2-(4-propylcyclohexyl)ethenyl]-5-propylpyrimidine (CID 139679897) is 2-[(E)-1,2-difluoro-2-(4-propylcyclohexyl)ethenyl]-5-propylpyrimidine.
What is the SMILES notation for 2-[(E)-1,2-difluoro-2-(4-propylcyclohexyl)ethenyl]-5-propylpyrimidine?
The canonical SMILES for 2-[(E)-1,2-difluoro-2-(4-propylcyclohexyl)ethenyl]-5-propylpyrimidine is CCCc1cnc(/C(F)=C(\F)C2CCC(CCC)CC2)nc1.
What is the InChIKey of 2-[(E)-1,2-difluoro-2-(4-propylcyclohexyl)ethenyl]-5-propylpyrimidine?
The InChIKey is IPIQOQXOLIYGHZ-WUKNDPDISA-N. The full InChI is InChI=1S/C18H26F2N2/c1-3-5-13-7-9-15(10-8-13)16(19)17(20)18-21-11-14(6-4-2)12-22-18/h11-13,15H,3-10H2,1-2H3/b17-16+.
What are the key properties of 2-[(E)-1,2-difluoro-2-(4-propylcyclohexyl)ethenyl]-5-propylpyrimidine?
2-[(E)-1,2-difluoro-2-(4-propylcyclohexyl)ethenyl]-5-propylpyrimidine has a molecular weight of 308.42 g/mol, XLogP of 5.64, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(E)-1,2-difluoro-2-(4-propylcyclohexyl)ethenyl]-5-propylpyrimidine is sourced from PubChem (CID 139679897), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).