C9H14N2O — CID 139680163
4-methyl-4,4a,5,6,7,8-hexahydro-2H-cinnolin-3-one (PubChem CID 139680163) has the molecular formula C9H14N2O and a molecular weight of 166.22 g/mol. Its IUPAC name is 4-methyl-4,4a,5,6,7,8-hexahydro-2H-cinnolin-3-one.
| Compound Name | 4-methyl-4,4a,5,6,7,8-hexahydro-2H-cinnolin-3-one |
|---|---|
| PubChem CID | 139680163 |
| Molecular Formula | C9H14N2O |
| Molecular Weight | 166.22 g/mol |
| Exact Mass | 166.11 |
| IUPAC Name | 4-methyl-4,4a,5,6,7,8-hexahydro-2H-cinnolin-3-one |
| SMILES | CC1C(=O)NN=C2CCCCC21 |
| InChI | InChI=1S/C9H14N2O/c1-6-7-4-2-3-5-8(7)10-11-9(6)12/h6-7H,2-5H2,1H3,(H,11,12) |
| InChIKey | GAACDBJQXHISOQ-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.22 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |