C23H25FN4O5 — CID 139680172
3-[3-[4-(4-fluorophenyl)piperazin-1-yl]propyl]-10,13-dioxa-3,4-diazatricyclo[7.4.1.05,14]tetradeca-1(14),4-diene-2,11,12-trione (PubChem CID 139680172) has the molecular formula C23H25FN4O5 and a molecular weight of 456.47 g/mol. Its IUPAC name is 3-[3-[4-(4-fluorophenyl)piperazin-1-yl]propyl]-10,13-dioxa-3,4-diazatricyclo[7.4.1.05,14]tetradeca-1(14),4-diene-2,11,12-trione.
| Compound Name | 3-[3-[4-(4-fluorophenyl)piperazin-1-yl]propyl]-10,13-dioxa-3,4-diazatricyclo[7.4.1.05,14]tetradeca-1(14),4-diene-2,11,12-trione |
|---|---|
| PubChem CID | 139680172 |
| Molecular Formula | C23H25FN4O5 |
| Molecular Weight | 456.47 g/mol |
| Exact Mass | 456.18 |
| IUPAC Name | 3-[3-[4-(4-fluorophenyl)piperazin-1-yl]propyl]-10,13-dioxa-3,4-diazatricyclo[7.4.1.05,14]tetradeca-1(14),4-diene-2,11,12-trione |
| SMILES | O=C1Oc2c3c(nn(CCCN4CCN(c5ccc(F)cc5)CC4)c2=O)CCCC3OC1=O |
| InChI | InChI=1S/C23H25FN4O5/c24-15-5-7-16(8-6-15)27-13-11-26(12-14-27)9-2-10-28-21(29)20-19-17(25-28)3-1-4-18(19)32-22(30)23(31)33-20/h5-8,18H,1-4,9-14H2 |
| InChIKey | KHWAMWAAWJXZOF-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 93.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.47 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|