C25H26F3N3OS — CID 139680252
3-[[4-(3,3-dimethylbut-1-ynyl)phenyl]methyl]-5-(4-methylphenyl)-2-(2,2,2-trifluoroethylimino)-1,3,5-thiadiazinan-4-one (PubChem CID 139680252) has the molecular formula C25H26F3N3OS and a molecular weight of 473.56 g/mol. Its IUPAC name is 3-[[4-(3,3-dimethylbut-1-ynyl)phenyl]methyl]-5-(4-methylphenyl)-2-(2,2,2-trifluoroethylimino)-1,3,5-thiadiazinan-4-one.
| Compound Name | 3-[[4-(3,3-dimethylbut-1-ynyl)phenyl]methyl]-5-(4-methylphenyl)-2-(2,2,2-trifluoroethylimino)-1,3,5-thiadiazinan-4-one |
|---|---|
| PubChem CID | 139680252 |
| Molecular Formula | C25H26F3N3OS |
| Molecular Weight | 473.56 g/mol |
| Exact Mass | 473.17 |
| IUPAC Name | 3-[[4-(3,3-dimethylbut-1-ynyl)phenyl]methyl]-5-(4-methylphenyl)-2-(2,2,2-trifluoroethylimino)-1,3,5-thiadiazinan-4-one |
| SMILES | Cc1ccc(N2CS/C(=N\CC(F)(F)F)N(Cc3ccc(C#CC(C)(C)C)cc3)C2=O)cc1 |
| InChI | InChI=1S/C25H26F3N3OS/c1-18-5-11-21(12-6-18)31-17-33-22(29-16-25(26,27)28)30(23(31)32)15-20-9-7-19(8-10-20)13-14-24(2,3)4/h5-12H,15-17H2,1-4H3/b29-22- |
| InChIKey | YSUGTQMMYHHJRP-IADYIPOJSA-N |
| XLogP | 6.44 |
| TPSA | 35.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.56 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|