C48H40N6O8S — CID 139680392
(2Z)-2-[[5-[4,5-bis[(4-methoxyphenyl)methoxy]-2-pyridinyl]-1,3,4-oxadiazol-2-yl]methoxyimino]-2-[2-(tritylamino)-1,3-thiazol-4-yl]acetic acid (PubChem CID 139680392) has the molecular formula C48H40N6O8S and a molecular weight of 860.95 g/mol. Its IUPAC name is (2Z)-2-[[5-[4,5-bis[(4-methoxyphenyl)methoxy]-2-pyridinyl]-1,3,4-oxadiazol-2-yl]methoxyimino]-2-[2-(tritylamino)-1,3-thiazol-4-yl]acetic acid.
| Compound Name | (2Z)-2-[[5-[4,5-bis[(4-methoxyphenyl)methoxy]-2-pyridinyl]-1,3,4-oxadiazol-2-yl]methoxyimino]-2-[2-(tritylamino)-1,3-thiazol-4-yl]acetic acid |
|---|---|
| PubChem CID | 139680392 |
| Molecular Formula | C48H40N6O8S |
| Molecular Weight | 860.95 g/mol |
| Exact Mass | 860.26 |
| IUPAC Name | (2Z)-2-[[5-[4,5-bis[(4-methoxyphenyl)methoxy]-2-pyridinyl]-1,3,4-oxadiazol-2-yl]methoxyimino]-2-[2-(tritylamino)-1,3-thiazol-4-yl]acetic acid |
| SMILES | COc1ccc(COc2cnc(-c3nnc(CO/N=C(\C(=O)O)c4csc(NC(c5ccccc5)(c5ccccc5)c5ccccc5)n4)o3)cc2OCc2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C48H40N6O8S/c1-57-37-22-18-32(19-23-37)28-59-41-26-39(49-27-42(41)60-29-33-20-24-38(58-2)25-21-33)45-53-52-43(62-45)30-61-54-44(46(55)56)40-31-63-47(50-40)51-48(34-12-6-3-7-13-34,35-14-8-4-9-15-35)36-16-10-5-11-17-36/h3-27,31H,28-30H2,1-2H3,(H,50,51)(H,55,56)/b54-44- |
| InChIKey | VWIKLNQXAQJZFU-ZCPJAKAISA-N |
| XLogP | 9.17 |
| TPSA | 172.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 63 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 860.95 |
| LogP ≤ 5 | 9.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|