C25H23NO4 — CID 139680861
2-methyl-3-[4-[[2-(2,4,5-trimethyl-3,6-dioxocyclohexa-1,4-dien-1-yl)-3-pyridinyl]methyl]phenyl]prop-2-enoic acid (PubChem CID 139680861) has the molecular formula C25H23NO4 and a molecular weight of 401.46 g/mol. Its IUPAC name is 2-methyl-3-[4-[[2-(2,4,5-trimethyl-3,6-dioxocyclohexa-1,4-dien-1-yl)-3-pyridinyl]methyl]phenyl]prop-2-enoic acid.
| Compound Name | 2-methyl-3-[4-[[2-(2,4,5-trimethyl-3,6-dioxocyclohexa-1,4-dien-1-yl)-3-pyridinyl]methyl]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 139680861 |
| Molecular Formula | C25H23NO4 |
| Molecular Weight | 401.46 g/mol |
| Exact Mass | 401.16 |
| IUPAC Name | 2-methyl-3-[4-[[2-(2,4,5-trimethyl-3,6-dioxocyclohexa-1,4-dien-1-yl)-3-pyridinyl]methyl]phenyl]prop-2-enoic acid |
| SMILES | CC(=Cc1ccc(Cc2cccnc2C2=C(C)C(=O)C(C)=C(C)C2=O)cc1)C(=O)O |
| InChI | InChI=1S/C25H23NO4/c1-14(25(29)30)12-18-7-9-19(10-8-18)13-20-6-5-11-26-22(20)21-17(4)23(27)15(2)16(3)24(21)28/h5-12H,13H2,1-4H3,(H,29,30) |
| InChIKey | UJQVDOUSQJSHMO-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 84.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.46 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|