C30H40N2O5S — CID 139681794
(5Z)-3-butyl-5-[(Z)-4,7-dihydroxyhept-2-enylidene]-4-hydroxy-2-(1-methylimidazol-2-yl)sulfanyl-4-(4-phenoxybutyl)cyclopent-2-en-1-one (PubChem CID 139681794) has the molecular formula C30H40N2O5S and a molecular weight of 540.73 g/mol. Its IUPAC name is (5Z)-3-butyl-5-[(Z)-4,7-dihydroxyhept-2-enylidene]-4-hydroxy-2-(1-methylimidazol-2-yl)sulfanyl-4-(4-phenoxybutyl)cyclopent-2-en-1-one.
| Compound Name | (5Z)-3-butyl-5-[(Z)-4,7-dihydroxyhept-2-enylidene]-4-hydroxy-2-(1-methylimidazol-2-yl)sulfanyl-4-(4-phenoxybutyl)cyclopent-2-en-1-one |
|---|---|
| PubChem CID | 139681794 |
| Molecular Formula | C30H40N2O5S |
| Molecular Weight | 540.73 g/mol |
| Exact Mass | 540.27 |
| IUPAC Name | (5Z)-3-butyl-5-[(Z)-4,7-dihydroxyhept-2-enylidene]-4-hydroxy-2-(1-methylimidazol-2-yl)sulfanyl-4-(4-phenoxybutyl)cyclopent-2-en-1-one |
| SMILES | CCCCC1=C(Sc2nccn2C)C(=O)/C(=C\C=C/C(O)CCCO)C1(O)CCCCOc1ccccc1 |
| InChI | InChI=1S/C30H40N2O5S/c1-3-4-16-26-28(38-29-31-19-20-32(29)2)27(35)25(17-10-12-23(34)13-11-21-33)30(26,36)18-8-9-22-37-24-14-6-5-7-15-24/h5-7,10,12,14-15,17,19-20,23,33-34,36H,3-4,8-9,11,13,16,18,21-22H2,1-2H3/b12-10-,25-17+ |
| InChIKey | HQZGXERSIAUAOG-CFJKROONSA-N |
| XLogP | 5.14 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.73 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|