C30H38O5S — CID 139682306
methyl 7-[5-(3-cyclopentyl-3-hydroxyprop-1-enyl)-2-oxo-3-(3-phenylpropylsulfanyl)cyclopent-3-en-1-yl]-7-hydroxyhept-5-ynoate (PubChem CID 139682306) has the molecular formula C30H38O5S and a molecular weight of 510.70 g/mol. Its IUPAC name is methyl 7-[5-(3-cyclopentyl-3-hydroxyprop-1-enyl)-2-oxo-3-(3-phenylpropylsulfanyl)cyclopent-3-en-1-yl]-7-hydroxyhept-5-ynoate.
| Compound Name | methyl 7-[5-(3-cyclopentyl-3-hydroxyprop-1-enyl)-2-oxo-3-(3-phenylpropylsulfanyl)cyclopent-3-en-1-yl]-7-hydroxyhept-5-ynoate |
|---|---|
| PubChem CID | 139682306 |
| Molecular Formula | C30H38O5S |
| Molecular Weight | 510.70 g/mol |
| Exact Mass | 510.24 |
| IUPAC Name | methyl 7-[5-(3-cyclopentyl-3-hydroxyprop-1-enyl)-2-oxo-3-(3-phenylpropylsulfanyl)cyclopent-3-en-1-yl]-7-hydroxyhept-5-ynoate |
| SMILES | COC(=O)CCCC#CC(O)C1C(=O)C(SCCCc2ccccc2)=CC1C=CC(O)C1CCCC1 |
| InChI | InChI=1S/C30H38O5S/c1-35-28(33)17-7-3-6-16-26(32)29-24(18-19-25(31)23-14-8-9-15-23)21-27(30(29)34)36-20-10-13-22-11-4-2-5-12-22/h2,4-5,11-12,18-19,21,23-26,29,31-32H,3,7-10,13-15,17,20H2,1H3 |
| InChIKey | HRJAYDYSWICTQQ-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.70 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|