C10H5F6N3S — CID 139682373
5-[3,5-bis(trifluoromethyl)phenyl]sulfanyl-1H-1,2,4-triazole (PubChem CID 139682373) has the molecular formula C10H5F6N3S and a molecular weight of 313.23 g/mol. Its IUPAC name is 5-[3,5-bis(trifluoromethyl)phenyl]sulfanyl-1H-1,2,4-triazole.
| Compound Name | 5-[3,5-bis(trifluoromethyl)phenyl]sulfanyl-1H-1,2,4-triazole |
|---|---|
| PubChem CID | 139682373 |
| Molecular Formula | C10H5F6N3S |
| Molecular Weight | 313.23 g/mol |
| Exact Mass | 313.01 |
| IUPAC Name | 5-[3,5-bis(trifluoromethyl)phenyl]sulfanyl-1H-1,2,4-triazole |
| SMILES | FC(F)(F)c1cc(Sc2ncn[nH]2)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C10H5F6N3S/c11-9(12,13)5-1-6(10(14,15)16)3-7(2-5)20-8-17-4-18-19-8/h1-4H,(H,17,18,19) |
| InChIKey | XHTMRNHFSODOTN-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.23 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |