C7H5F6N — CID 139682401
1,2,3-trifluoro-4-(trifluoromethyl)cyclohexa-2,4-dien-1-amine (PubChem CID 139682401) has the molecular formula C7H5F6N and a molecular weight of 217.11 g/mol. Its IUPAC name is 1,2,3-trifluoro-4-(trifluoromethyl)cyclohexa-2,4-dien-1-amine.
| Compound Name | 1,2,3-trifluoro-4-(trifluoromethyl)cyclohexa-2,4-dien-1-amine |
|---|---|
| PubChem CID | 139682401 |
| Molecular Formula | C7H5F6N |
| Molecular Weight | 217.11 g/mol |
| Exact Mass | 217.03 |
| IUPAC Name | 1,2,3-trifluoro-4-(trifluoromethyl)cyclohexa-2,4-dien-1-amine |
| SMILES | NC1(F)CC=C(C(F)(F)F)C(F)=C1F |
| InChI | InChI=1S/C7H5F6N/c8-4-3(7(11,12)13)1-2-6(10,14)5(4)9/h1H,2,14H2 |
| InChIKey | MOBQXFQHGSBEBT-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.11 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|